EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44N7O17P3S |
| Net Charge | -4 |
| Average Mass | 875.681 |
| Monoisotopic Mass | 875.17492 |
| SMILES | CCCCC(C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C28H48N7O17P3S/c1-5-6-7-16(2)27(40)56-11-10-30-18(36)8-9-31-25(39)22(38)28(3,4)13-49-55(46,47)52-54(44,45)48-12-17-21(51-53(41,42)43)20(37)26(50-17)35-15-34-19-23(29)32-14-33-24(19)35/h14-17,20-22,26,37-38H,5-13H2,1-4H3,(H,30,36)(H,31,39)(H,44,45)(H,46,47)(H2,29,32,33)(H2,41,42,43)/p-4/t16?,17-,20-,21-,22+,26-/m1/s1 |
| InChIKey | QZBBWKARTWOCMU-CRVKRRNDSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylhexanoyl-CoA(4−) (CHEBI:90156) is a methyl-branched fatty acyl-CoA(4−) (CHEBI:183508) |
| 2-methylhexanoyl-CoA(4−) (CHEBI:90156) is conjugate base of 2-methylhexanoyl-CoA (CHEBI:90224) |
| Incoming Relation(s) |
| 2-methylhexanoyl-CoA (CHEBI:90224) is conjugate acid of 2-methylhexanoyl-CoA(4−) (CHEBI:90156) |
| Synonyms | Source |
|---|---|
| 2-methylcaproyl-CoA(4−) | SUBMITTER |
| 2-methylhexanoyl-coenzyme A(4−) | ChEBI |
| 2-methylcaproyl-coenzyme A(4−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methylhexanoyl-CoA | UniProt |
| Citations |
|---|