EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45N9O12 |
| Net Charge | 0 |
| Average Mass | 687.708 |
| Monoisotopic Mass | 687.31877 |
| SMILES | CC(=O)N(O)CCC[C@@H]1NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](CCCN(O)C(C)=O)NC(=O)[C@H](CCCN(O)C(C)=O)NC1=O |
| InChI | InChI=1S/C27H45N9O12/c1-16(37)34(46)10-4-7-19-25(43)30-14-23(41)28-13-22(40)29-15-24(42)31-20(8-5-11-35(47)17(2)38)26(44)33-21(27(45)32-19)9-6-12-36(48)18(3)39/h19-21,46-48H,4-15H2,1-3H3,(H,28,41)(H,29,40)(H,30,43)(H,31,42)(H,32,45)(H,33,44)/t19-,20-,21-/m0/s1 |
| InChIKey | ZFDAUYPBCXMSBF-ACRUOGEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS87) | ||
| - | DOI (10.1371/journal.pone.0115359) |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deferrichrome (CHEBI:90132) has role siderophore (CHEBI:26672) |
| deferrichrome (CHEBI:90132) is a homodetic cyclic peptide (CHEBI:24613) |
| deferrichrome (CHEBI:90132) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| cyclo(glycyl-N5-acetyl-N5-hydroxy-L-ornithyl-N5-acetyl-N5-hydroxy-L-ornithyl-N5-acetyl-N5-hydroxy-L-ornithylglycylglycyl) |
| Synonyms | Source |
|---|---|
| desferrichrome | ChEBI |
| ferrichrome with no bound iron | MetaCyc |
| N-Desferriferrichrome | ChEBI |
| N-Dffc | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD0-2205 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5220926 | Reaxys |
| CAS:34787-28-5 | ChemIDplus |