EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H20N2O4 |
| Net Charge | 0 |
| Average Mass | 544.566 |
| Monoisotopic Mass | 544.14231 |
| SMILES | O=C1C(C2=C3C(=Nc4ccccc43)/C(=C\c3ccc(O)cc3)C2=O)=C2C(=Nc3ccccc32)/C1=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C36H20N2O4/c39-21-13-9-19(10-14-21)17-25-33-29(23-5-1-3-7-27(23)37-33)31(35(25)41)32-30-24-6-2-4-8-28(24)38-34(30)26(36(32)42)18-20-11-15-22(40)16-12-20/h1-18,39-40H/b25-17+,26-18+ |
| InChIKey | CGZKSPLDUIRCIO-RPCRKUJJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scytonema sp. (ncbitaxon:1542952) | - | PubMed (25226055) | Strain: R77DM |
| Lyngbya (ncbitaxon:28073) | - | PubMed (24111939) | Strain: CU2555 |
| Roles Classification |
|---|
| Chemical Role: | ultraviolet filter A photochemical role realized in the absorption of ultraviolet light, for example to protect skin cells from damage. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scytonemin (CHEBI:90127) has role bacterial metabolite (CHEBI:76969) |
| scytonemin (CHEBI:90127) has role biological pigment (CHEBI:26130) |
| scytonemin (CHEBI:90127) has role ultraviolet filter (CHEBI:73335) |
| scytonemin (CHEBI:90127) is a enone (CHEBI:51689) |
| scytonemin (CHEBI:90127) is a organic heterotricyclic compound (CHEBI:26979) |
| scytonemin (CHEBI:90127) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| scytonemin (CHEBI:90127) is a polyphenol (CHEBI:26195) |
| scytonemin (CHEBI:90127) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (3E,3'E)-3,3'-bis[(4-hydroxyphenyl)methylidene][1,1'-bicyclopenta[b]indole]-2,2'(3H,3'H)-dione |
| Manual Xrefs | Databases |
|---|---|
| C00045068 | KNApSAcK |
| Scytonemin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22043325 | Reaxys |
| CAS:152075-98-4 | ChemIDplus |
| Citations |
|---|