EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O3.C25H37NO4 |
| Net Charge | 0 |
| Average Mass | 603.756 |
| Monoisotopic Mass | 603.31960 |
| SMILES | O=C(O)c1ccc2ccccc2c1O.OCc1cc(C(O)CNCCCCCCOCCCCc2ccccc2)ccc1O |
| InChI | InChI=1S/C25H37NO4.C11H8O3/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21;12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2;1-6,12H,(H,13,14) |
| InChIKey | XTZNCVSCVHTPAI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salmeterol xinafoate (CHEBI:9012) is a naphthoic acid (CHEBI:25483) |
| Synonyms | Source |
|---|---|
| Salmeterol xinafoate | KEGG COMPOUND |
| Serevent | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D00687 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:94749-08-3 | KEGG COMPOUND |