EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90117 - indigo carmine (acid form)
| Formula | C16H10N2O8S2 |
| Net Charge | 0 |
| Average Mass | 422.396 |
| Monoisotopic Mass | 421.98786 |
| SMILES | O=C1/C(=C2\Nc3ccc(S(=O)(=O)O)cc3C2=O)Nc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C16H10N2O8S2/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14/h1-6,17-18H,(H,21,22,23)(H,24,25,26)/b14-13+ |
| InChIKey | CFZXDJWFRVEWSR-BUHFOSPRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indigo carmine (acid form) (CHEBI:90117) has role food colouring (CHEBI:77182) |
| indigo carmine (acid form) (CHEBI:90117) has role histological dye (CHEBI:77178) |
| indigo carmine (acid form) (CHEBI:90117) is a arenesulfonic acid (CHEBI:33555) |
| indigo carmine (acid form) (CHEBI:90117) is a enone (CHEBI:51689) |
| indigo carmine (acid form) (CHEBI:90117) is a indolones (CHEBI:24829) |
| indigo carmine (acid form) (CHEBI:90117) is a olefinic compound (CHEBI:78840) |
| indigo carmine (acid form) (CHEBI:90117) is a ring assembly (CHEBI:36820) |
| indigo carmine (acid form) (CHEBI:90117) is conjugate acid of indigo carmine(2−) (CHEBI:90120) |
| Incoming Relation(s) |
| indigo carmine(2−) (CHEBI:90120) is conjugate base of indigo carmine (acid form) (CHEBI:90117) |
| IUPAC Name |
|---|
| (2E)-3-oxo-2-(3-oxo-5-sulfo-1,3-dihydro-2H-indol-2-ylidene)-2,3-dihydro-1H-indole-5-sulfonic acid |
| Synonyms | Source |
|---|---|
| indigo carmine free acid | ChEBI |
| Indigotindisulfonic acid | ChemIDplus |
| Indigotindisulfonate | ChemIDplus |
| 2-(1,3-Dihydro-3-oxo-5-sulpho-2H-indol-2-ylidene)-3-oxoindoline-5-sulphonic acid | ChemIDplus |
| indigo-5,5'-disulfonic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059912 | HMDB |
| Indigo_carmine | Wikipedia |
| 4575 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:64330 | Reaxys |
| CAS:483-20-5 | ChemIDplus |