EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | O=C1C=C2CC3(O)COc4c(ccc(O)c4O)C3=C2C=C1O |
| InChI | InChI=1S/C16H12O6/c17-10-2-1-8-13-9-4-12(19)11(18)3-7(9)5-16(13,21)6-22-15(8)14(10)20/h1-4,17,19-21H,5-6H2 |
| InChIKey | HLUCICHZHWJHLL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hematein (CHEBI:90116) has role histological dye (CHEBI:77178) |
| hematein (CHEBI:90116) is a enol (CHEBI:33823) |
| hematein (CHEBI:90116) is a organic heterotetracyclic compound (CHEBI:38163) |
| hematein (CHEBI:90116) is a phenols (CHEBI:33853) |
| hematein (CHEBI:90116) is a quinomethanes (CHEBI:52404) |
| hematein (CHEBI:90116) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 3,4,6a,10-tetrahydroxy-6a,7-dihydrobenzo[b]indeno[1,2-d]pyran-9(6H)-one |
| Synonyms | Source |
|---|---|
| C.I. 75290 | ChEBI |
| Haematine | ChEBI |
| Natural black 1 | ChEBI |
| Hematine | ChemIDplus |