EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N3.HCl |
| Net Charge | 0 |
| Average Mass | 379.935 |
| Monoisotopic Mass | 379.18153 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=N)C=C2)c2ccc(N(C)C)cc2)cc1.Cl |
| InChI | InChI=1S/C23H25N3.ClH/c1-25(2)21-13-7-18(8-14-21)23(17-5-11-20(24)12-6-17)19-9-15-22(16-10-19)26(3)4;/h5-16,24H,1-4H3;1H |
| InChIKey | WWKGVZASJYXZKN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl violet 2B (CHEBI:90108) has part Methyl violet 2B(1+) (CHEBI:90111) |
| Methyl violet 2B (CHEBI:90108) has role antineoplastic agent (CHEBI:35610) |
| Methyl violet 2B (CHEBI:90108) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| Methyl violet 2B (CHEBI:90108) has role fluorochrome (CHEBI:51217) |
| Methyl violet 2B (CHEBI:90108) has role histological dye (CHEBI:77178) |
| Methyl violet 2B (CHEBI:90108) has role mutagen (CHEBI:25435) |
| Methyl violet 2B (CHEBI:90108) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 4,4'-[(4-iminocyclohexa-2,5-dien-1-ylidene)methylene]bis(N,N-dimethylaniline) hydrochloride |
| 4-{bis[4-(dimethylamino)phenyl]methylidene}cyclohexa-2,5-dien-1-iminium chloride |
| Synonym | Source |
|---|---|
| C.I. 42535 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24690838 | Reaxys |
| Citations |
|---|