EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25N3.HCl |
| Net Charge | 0 |
| Average Mass | 379.935 |
| Monoisotopic Mass | 379.18153 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=N)C=C2)c2ccc(N(C)C)cc2)cc1.Cl |
| InChI | InChI=1S/C23H25N3.ClH/c1-25(2)21-13-7-18(8-14-21)23(17-5-11-20(24)12-6-17)19-9-15-22(16-10-19)26(3)4;/h5-16,24H,1-4H3;1H |
| InChIKey | WWKGVZASJYXZKN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl violet 2B (CHEBI:90108) has part Methyl violet 2B(1+) (CHEBI:90111) |
| Methyl violet 2B (CHEBI:90108) has role antineoplastic agent (CHEBI:35610) |
| Methyl violet 2B (CHEBI:90108) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| Methyl violet 2B (CHEBI:90108) has role fluorochrome (CHEBI:51217) |
| Methyl violet 2B (CHEBI:90108) has role histological dye (CHEBI:77178) |
| Methyl violet 2B (CHEBI:90108) has role mutagen (CHEBI:25435) |
| Methyl violet 2B (CHEBI:90108) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 4,4'-[(4-iminocyclohexa-2,5-dien-1-ylidene)methylene]bis(N,N-dimethylaniline) hydrochloride |
| 4-{bis[4-(dimethylamino)phenyl]methylidene}cyclohexa-2,5-dien-1-iminium chloride |
| Synonym | Source |
|---|---|
| C.I. 42535 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24690838 | Reaxys |
| Citations |
|---|