EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13N2O5.Cl |
| Net Charge | 0 |
| Average Mass | 336.731 |
| Monoisotopic Mass | 336.05130 |
| SMILES | CN(C)c1ccc2nc3c(C(=O)O)cc(O)c(O)c3[o+]c2c1.[Cl-] |
| InChI | InChI=1S/C15H12N2O5.ClH/c1-17(2)7-3-4-9-11(5-7)22-14-12(16-9)8(15(20)21)6-10(18)13(14)19;/h3-6H,1-2H3,(H2-,16,18,19,20,21);1H |
| InChIKey | ADAUKUOAOMLVSN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gallocyanin (CHEBI:90106) has part gallocyanin(1+) (CHEBI:90107) |
| gallocyanin (CHEBI:90106) has role fluorochrome (CHEBI:51217) |
| gallocyanin (CHEBI:90106) has role histological dye (CHEBI:77178) |
| gallocyanin (CHEBI:90106) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 1-carboxy-7-(dimethylamino)-3,4-dihydroxyphenoxazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| Alizarine Navy Blue AT | ChemIDplus |
| Anthracene Blue SWGG | ChemIDplus |
| Brilliant Chrome Blue P | ChemIDplus |
| C.I. 51030 | ChEBI |
| C.I. Mordant Blue 10 | ChemIDplus |
| Fast Violet | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1562-85-2 | ChemIDplus |