EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC(C)=C[C@H]1C[C@@H](C)CCO1 |
| InChI | InChI=1S/C10H18O/c1-8(2)6-10-7-9(3)4-5-11-10/h6,9-10H,4-5,7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | CZCBTSFUTPZVKJ-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,4S)-rose oxide (CHEBI:90102) is a rose oxide (CHEBI:90075) |
| (2R,4S)-rose oxide (CHEBI:90102) is enantiomer of (2S,4R)-rose oxide (CHEBI:90098) |
| Incoming Relation(s) |
| (2S,4R)-rose oxide (CHEBI:90098) is enantiomer of (2R,4S)-rose oxide (CHEBI:90102) |
| IUPAC Name |
|---|
| (2R,4S)-4-methyl-2-(2-methylprop-1-en-1-yl)tetrahydro-2H-pyran |
| Synonyms | Source |
|---|---|
| (+)-cis-rose oxide | ChEBI |
| (2R,4S)-(+)-4-methyl-2-(2-methylprop-1-en-1-yl)tetrahydro-2H-pyran | ChEBI |
| (+)-(2R,4S)-4-methyl-2-(2-methylprop-1-en-1-yl)tetrahydro-2H-pyran | ChEBI |
| cis-(+)-rose oxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1281401 | Reaxys |
| CAS:4610-11-1 | ChemIDplus |
| Citations |
|---|