EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO4 |
| Net Charge | 0 |
| Average Mass | 331.412 |
| Monoisotopic Mass | 331.17836 |
| SMILES | COc1ccc(C[C@@H](C)NC[C@H](O)c2ccc(O)c(CO)c2)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-13(9-14-3-6-17(24-2)7-4-14)20-11-19(23)15-5-8-18(22)16(10-15)12-21/h3-8,10,13,19-23H,9,11-12H2,1-2H3/t13-,19+/m1/s1 |
| InChIKey | VPMWDFRZSIMDKW-YJYMSZOUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salmefamol (CHEBI:9010) is a amphetamines (CHEBI:35338) |
| Synonym | Source |
|---|---|
| Salmefamol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11771 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:18910-65-1 | KEGG COMPOUND |