EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N4O3 |
| Net Charge | 0 |
| Average Mass | 278.312 |
| Monoisotopic Mass | 278.13789 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H18N4O3/c14-13(15)16-8-4-7-10(12(19)20)17-11(18)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,17,18)(H,19,20)(H4,14,15,16)/t10-/m0/s1 |
| InChIKey | RSYYQCDERUOEFI-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzoyl-L-arginine (CHEBI:90086) has functional parent benzoic acid (CHEBI:30746) |
| N-benzoyl-L-arginine (CHEBI:90086) is a N-acyl-L-arginine (CHEBI:21645) |
| N-benzoyl-L-arginine (CHEBI:90086) is a benzamides (CHEBI:22702) |
| N-benzoyl-L-arginine (CHEBI:90086) is enantiomer of N-benzoyl-D-arginine (CHEBI:16820) |
| Incoming Relation(s) |
| N-benzoyl-D-arginine (CHEBI:16820) is enantiomer of N-benzoyl-L-arginine (CHEBI:90086) |
| IUPAC Names |
|---|
| N2-benzoyl-L-arginine |
| Nα-benzoyl-L-arginine |
| Synonyms | Source |
|---|---|
| Bz-Arg-OH | ChEBI |
| Bz-L-Arg-OH | ChEBI |
| α-N-benzoyl-L-arginine | ChEBI |
| Citations |
|---|