EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H28O2 |
| Net Charge | 0 |
| Average Mass | 228.376 |
| Monoisotopic Mass | 228.20893 |
| SMILES | CCCC(C)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O2/c1-3-10-13(2)11-8-6-4-5-7-9-12-14(15)16/h13H,3-12H2,1-2H3,(H,15,16) |
| InChIKey | OVRJJCKGCSPVGT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (24421258) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-Methyltridecanoic acid (CHEBI:90062) is a long-chain fatty acid (CHEBI:15904) |
| Synonyms | Source |
|---|---|
| 10-Methyltridecanoate | HMDB |
| 10-methyltridecanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061781 | HMDB |
| Citations |
|---|