EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N3O6 |
| Net Charge | 0 |
| Average Mass | 287.272 |
| Monoisotopic Mass | 287.11174 |
| SMILES | N[C@@H](Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cn1)C(=O)O |
| InChI | InChI=1S/C11H17N3O6/c12-6(11(18)19)1-5-2-14(4-13-5)10-9(17)8(16)7(3-15)20-10/h2,4,6-10,15-17H,1,3,12H2,(H,18,19)/t6-,7+,8+,9+,10+/m0/s1 |
| InChIKey | TTYCFBAOLXCFAB-VAPHQMJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (4030756) | ||
| blood (UBERON:0000178) | PubMed (4030756) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Ribosylhistidine (CHEBI:90055) is a glyco-amino acid (CHEBI:35258) |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-{1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-imidazol-4-yl}propanoic acid | HMDB |
| His-R | HMDB |
| N(Tau)-ribosylhistidine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002089 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:98379-91-0 | KEGG COMPOUND |
| Citations |
|---|