EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17NO |
| Net Charge | 0 |
| Average Mass | 179.263 |
| Monoisotopic Mass | 179.13101 |
| SMILES | CC(C(O)c1ccccc1)N(C)C |
| InChI | InChI=1S/C11H17NO/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9,11,13H,1-3H3 |
| InChIKey | FMCGSUUBYTWNDP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (24029555) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylephedrine (CHEBI:90046) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| (1R,2S)-(-)-N-Methylephedrine | HMDB |
| (1Rs,2Rs)-2-dimethylamino-1-phenylpropan-1-ol | HMDB |
| 2-(dimethylamino)-1-phenylpropan-1-ol | HMDB |
| Dl-Methylephedrine hydrochloride | HMDB |
| Erythro-alpha-[1-(dimethylamino)ethyl]benzyl alcohol | HMDB |
| L-Methylephedrine hydrochloride (JAN) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041932 | HMDB |
| methylephedrine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:552-79-4 | KEGG COMPOUND |
| Citations |
|---|