EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO6S |
| Net Charge | 0 |
| Average Mass | 249.244 |
| Monoisotopic Mass | 249.03071 |
| SMILES | NC[C@H](O)c1ccc(OS(=O)(=O)O)c(O)c1 |
| InChI | InChI=1S/C8H11NO6S/c9-4-7(11)5-1-2-8(6(10)3-5)15-16(12,13)14/h1-3,7,10-11H,4,9H2,(H,12,13,14)/t7-/m0/s1 |
| InChIKey | CVJMZWLHUCMEKO-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (8330610) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Norepinephrine sulfate (CHEBI:90022) is a catecholamine (CHEBI:33567) |
| Norepinephrine sulfate (CHEBI:90022) is tautomer of (R)-noradrenaline 4'-O-sulfate zwitterion (CHEBI:233044) |
| Incoming Relation(s) |
| (R)-noradrenaline 4'-O-sulfate zwitterion (CHEBI:233044) is tautomer of Norepinephrine sulfate (CHEBI:90022) |
| Synonyms | Source |
|---|---|
| {4-[(1R)-2-amino-1-hydroxyethyl]-2-hydroxyphenyl}oxidanesulfonic acid | HMDB |
| Noradrenaline sulfate | HMDB |
| Noradrenaline sulfoconjugate | HMDB |
| Noradrenaline sulphate | HMDB |
| Norepinephrine-3-O-sulfate | HMDB |
| Norepinephrine-3-O-sulphate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002062 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:77469-51-3 | KEGG COMPOUND |
| Citations |
|---|