EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=C(C)C1C=CC(C)CC1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,9-10H,1,5,7H2,2-3H3 |
| InChIKey | TWCNAXRPQBLSNO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus medica (ncbitaxon:171251) | - | PubMed (29594287) | |
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (24421258) | |
| Schisandra chinensis (ncbitaxon:50507) | - | DOI (10.1002/jssc.200800341) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isolimonene (CHEBI:90014) has role human metabolite (CHEBI:77746) |
| isolimonene (CHEBI:90014) has role plant metabolite (CHEBI:76924) |
| isolimonene (CHEBI:90014) is a p-menthadiene (CHEBI:50073) |
| isolimonene (CHEBI:90014) is a cycloalkene (CHEBI:33643) |
| IUPAC Name |
|---|
| 3-methyl-6-(prop-1-en-2-yl)cyclohexene |
| Synonyms | Source |
|---|---|
| 2,8-p-menthadiene | NIST Chemistry WebBook |
| 3-methyl-6-(prop-1-en-2-yl)cyclohex-1-ene | IUPAC |
| 3-methyl-6-prop-1-en-2-ylcyclohexene | ChEBI |
| 6-methyl-3-(1-methylethenyl)cyclohexene | ChEBI |
| p-mentha-2,8(10)-diene | ChEBI |
| iso-limonene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 454695 | ChemSpider |
| HMDB0061793 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:499-99-0 | ChEBI |
| Citations |
|---|