EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | CCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-2-3-5(8)7-4-6(9)10/h2-4H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | WPSSBBPLVMTKRN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (10404733) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butyrylglycine (CHEBI:89963) has functional parent butyric acid (CHEBI:30772) |
| butyrylglycine (CHEBI:89963) has role human urinary metabolite (CHEBI:84087) |
| butyrylglycine (CHEBI:89963) is a N-acylglycine (CHEBI:16180) |
| butyrylglycine (CHEBI:89963) is conjugate acid of butyrylglycinate (CHEBI:132937) |
| Incoming Relation(s) |
| butyrylglycinate (CHEBI:132937) is conjugate base of butyrylglycine (CHEBI:89963) |
| IUPAC Name |
|---|
| N-butanoylglycine |
| Synonyms | Source |
|---|---|
| 2-butanamidoacetic acid | HMDB |
| 2-butyramidoacetic acid | ChEBI |
| butanamidoacetic acid | ChEBI |
| butyramidoacetic acid | ChEBI |
| N-(1-Oxobutyl)glycine | HMDB |
| N-Butyrylglycine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000808 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1766058 | Reaxys |
| CAS:20208-73-5 | ChemIDplus |
| Citations |
|---|