EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:89951 - Normetanephrine
| Formula | C9H13NO3 |
| Net Charge | 0 |
| Average Mass | 183.207 |
| Monoisotopic Mass | 183.08954 |
| SMILES | COc1cc(C(O)CN)ccc1O |
| InChI | InChI=1S/C9H13NO3/c1-13-9-4-6(8(12)5-10)2-3-7(9)11/h2-4,8,11-12H,5,10H2,1H3 |
| InChIKey | YNYAYWLBAHXHLL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (2026685) | ||
| blood (UBERON:0000178) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 165-177. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp., Basel, Switzerland c1981-1992.) | ||
| cerebrospinal fluid (UBERON:0001359) | PubMed (4073504) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Normetanephrine (CHEBI:89951) is a catecholamine (CHEBI:33567) |
| Synonyms | Source |
|---|---|
| 3-Methoxy-Noradrenaline | HMDB |
| 3-O-Methyl-Noradrenaline | HMDB |
| 4-(2-amino-1-hydroxyethyl)-2-methoxyphenol | HMDB |
| 4-(2-Amino-1-hydroxyethyl)-2-methoxyphenol | HMDB |
| (+/-)-alpha-(aminomethyl)-4-hydroxy-3-methoxy-Benzenemethanol | HMDB |
| alpha-(Aminomethyl)-4-hydroxy-3-methoxy-Benzenemethanol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000819 | HMDB |
| Normetanephrine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:97-31-4 | KEGG COMPOUND |
| Citations |
|---|