EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O5S2 |
| Net Charge | 0 |
| Average Mass | 297.358 |
| Monoisotopic Mass | 297.04531 |
| SMILES | NC(CSSC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C8H15N3O5S2/c9-4(7(14)11-1-6(12)13)2-17-18-3-5(10)8(15)16/h4-5H,1-3,9-10H2,(H,11,14)(H,12,13)(H,15,16)/t4?,5-/m0/s1 |
| InChIKey | ZHRLECIZINSPKL-AKGZTFGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (7333014) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Cysteinylglycine disulfide (CHEBI:89930) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-({2-amino-2-[(carboxymethyl)carbamoyl]ethyl}disulfanyl)propanoic acid | HMDB |
| 3-[[2-Amino-2-[(carboxymethyl)carbamoyl]ethyl]dithio]-Alanine | HMDB |
| Cystinyl-GLY | HMDB |
| Cystinylglycine | HMDB |
| L-Cysteinyl-Glycine disulfide | HMDB |
| (R)-N-(3-((2-amino-2-carboxyethyl)dithio)-ala)-Gly | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000709 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:70555-24-7 | KEGG COMPOUND |
| Citations |
|---|