EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H38N4O14 |
| Net Charge | 0 |
| Average Mass | 786.747 |
| Monoisotopic Mass | 786.23845 |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4nc(cc5nc(cc1n2)c(CCC(=O)O)c5CC(=O)O)C(CCC(=O)O)=C4CC(=O)O)c(CCC(=O)O)c3CC(=O)O |
| InChI | InChI=1S/C39H38N4O14/c1-17-18(2-6-33(44)45)26-14-30-23(11-38(54)55)20(4-8-35(48)49)28(42-30)16-32-24(12-39(56)57)21(5-9-36(50)51)29(43-32)15-31-22(10-37(52)53)19(3-7-34(46)47)27(41-31)13-25(17)40-26/h13-16,41-42H,2-12H2,1H3,(H,44,45)(H,46,47)(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)/b25-13-,26-14-,27-13-,28-16-,29-15-,30-14-,31-15-,32-16- |
| InChIKey | GWTVAIDNCPVMLP-YBWGHNILSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (10905759) |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Heptacarboxylporphyrin I (CHEBI:89912) is a porphyrins (CHEBI:26214) |
| Synonyms | Source |
|---|---|
| 3-[9,14,19-tris(2-carboxyethyl)-10,15,20-tris(carboxymethyl)-5-methyl-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1,3(24),4,6,8,10,12,14,16(22),17,19-undecaen-4-yl]propanoic acid | HMDB |
| Heptacarboxylic acid porphyrin I | HMDB |
| Heptaporphyrin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000737 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:65406-45-3 | KEGG COMPOUND |
| Citations |
|---|