EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO5 |
| Net Charge | 0 |
| Average Mass | 265.265 |
| Monoisotopic Mass | 265.09502 |
| SMILES | CCC(=O)NC(OC(=O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H15NO5/c1-2-10(15)14-12(13(17)18)19-11(16)8-9-6-4-3-5-7-9/h3-7,12H,2,8H2,1H3,(H,14,15)(H,17,18) |
| InChIKey | CFIIOIQADIQNGQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (22279428) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-Phenylacetoxy)propionylglycine (CHEBI:89911) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| 2-[(2-phenylacetyl)oxy]-2-propanamidoacetic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059732 | HMDB |
| Citations |
|---|