EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O4 |
| Net Charge | 0 |
| Average Mass | 170.164 |
| Monoisotopic Mass | 170.05791 |
| SMILES | C=C(CC(=O)O)C(=C)CC(=O)O |
| InChI | InChI=1S/C8H10O4/c1-5(3-7(9)10)6(2)4-8(11)12/h1-4H2,(H,9,10)(H,11,12) |
| InChIKey | ZPWVTTHIHKYUQK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2338430) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-Methyleneadipic acid (CHEBI:89898) is a branched-chain fatty acid (CHEBI:35819) |
| Synonym | Source |
|---|---|
| 3,4-dimethylidenehexanedioic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059756 | HMDB |
| Citations |
|---|