EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO3 |
| Net Charge | 0 |
| Average Mass | 205.213 |
| Monoisotopic Mass | 205.07389 |
| SMILES | O=C(O)CC(O)c1cnc2ccccc12 |
| InChI | InChI=1S/C11H11NO3/c13-10(5-11(14)15)8-6-12-9-4-2-1-3-7(8)9/h1-4,6,10,12-13H,5H2,(H,14,15) |
| InChIKey | HWRVAGPWLQXABS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2338430) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Indolehydracrylic acid (CHEBI:89877) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonym | Source |
|---|---|
| 3-hydroxy-3-(1H-indol-3-yl)propanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059765 | HMDB |
| Citations |
|---|