EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:89862 - Threo-3-Hydroxy-2-methylbutyric acid
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | COC(=O)[C@H](C)[C@H](C)O |
| InChI | InChI=1S/C6H12O3/c1-4(5(2)7)6(8)9-3/h4-5,7H,1-3H3/t4-,5+/m1/s1 |
| InChIKey | FFJMPYODEQVBEX-UHNVWZDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2338430) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Threo-3-Hydroxy-2-methylbutyric acid (CHEBI:89862) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonym | Source |
|---|---|
| methyl (2R,3S)-3-hydroxy-2-methylbutanoate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059770 | HMDB |
| Citations |
|---|