EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO5 |
| Net Charge | 0 |
| Average Mass | 265.265 |
| Monoisotopic Mass | 265.09502 |
| SMILES | O=C(O)CC[C@H](NC(=O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H15NO5/c15-11(8-9-4-2-1-3-5-9)14-10(13(18)19)6-7-12(16)17/h1-5,10H,6-8H2,(H,14,15)(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | PTSRBZOZSRJCKX-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2338430) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Phenylacetylglutamic acid (CHEBI:89860) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| (2S)-2-(2-phenylacetamido)pentanedioic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059772 | HMDB |
| Citations |
|---|