EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | CCC(=O)NCC(=O)O |
| InChI | InChI=1S/C5H9NO3/c1-2-4(7)6-3-5(8)9/h2-3H2,1H3,(H,6,7)(H,8,9) |
| InChIKey | WOMAZEJKVZLLFE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propionylglycine (CHEBI:89836) has functional parent propionic acid (CHEBI:30768) |
| propionylglycine (CHEBI:89836) has role human urinary metabolite (CHEBI:84087) |
| propionylglycine (CHEBI:89836) is a N-acylglycine (CHEBI:16180) |
| propionylglycine (CHEBI:89836) is conjugate acid of propionylglycinate (CHEBI:132936) |
| Incoming Relation(s) |
| propionylglycinate (CHEBI:132936) is conjugate base of propionylglycine (CHEBI:89836) |
| IUPAC Name |
|---|
| N-propanoylglycine |
| Synonyms | Source |
|---|---|
| 2-propanamidoacetic acid | HMDB |
| N-Propionylglycine | HMDB |
| N-Propionyl-Glycine | HMDB |
| propanamidoacetic acid | IUPAC |
| propanoylglycine | ChEBI |
| propionylaminoacetic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000783 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1759032 | Reaxys |
| CAS:21709-90-0 | ChemIDplus |
| Citations |
|---|