EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | COc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C8H8O4/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,9H,1H3,(H,10,11) |
| InChIKey | IZZIWIAOVZOBLF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (19309105) | |
| Amycolatopsis sp. (ncbitaxon:37632) | - | PubMed (31728655) | Strain: Poz 14 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methoxysalicylic acid (CHEBI:89830) has role bacterial metabolite (CHEBI:76969) |
| 5-methoxysalicylic acid (CHEBI:89830) has role human urinary metabolite (CHEBI:84087) |
| 5-methoxysalicylic acid (CHEBI:89830) is a methoxysalicylic acid (CHEBI:149777) |
| IUPAC Name |
|---|
| 2-hydroxy-5-methoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 5-methoxy-2-hydroxybenzoic acid | ChemIDplus |
| 6-hydroxy-m-anisic acid | ChemIDplus |
| 5-MeOSA | ChEBI |
| acid5-methoxysalicylic | ChemIDplus |
| 5-O-methyl gentisic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001868 | HMDB |
| FDB011959 | FooDB |
| 5-Methoxysalicylic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2209647 | Reaxys |
| CAS:2612-02-4 | ChemIDplus |
| Citations |
|---|