EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | CC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H9NO4/c1-5(11)10-6-2-3-8(12)7(4-6)9(13)14/h2-4,12H,1H3,(H,10,11)(H,13,14) |
| InChIKey | GEFDRROBUCULOD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (21761941) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-5-aminosalicylic acid (CHEBI:89810) is a aminobenzoic acid (CHEBI:22495) |
| Synonym | Source |
|---|---|
| 5-acetamido-2-hydroxybenzoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060602 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:51-59-2 | KEGG COMPOUND |
| Citations |
|---|