EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17F4N3O2 |
| Net Charge | 0 |
| Average Mass | 431.389 |
| Monoisotopic Mass | 431.12569 |
| SMILES | COc1cc2c(cc1C(F)(F)F)N(C(=O)Nc1cc(F)cc(-c3cccnc3)c1)CC2 |
| InChI | InChI=1S/C22H17F4N3O2/c1-31-20-9-13-4-6-29(19(13)11-18(20)22(24,25)26)21(30)28-17-8-15(7-16(23)10-17)14-3-2-5-27-12-14/h2-3,5,7-12H,4,6H2,1H3,(H,28,30) |
| InChIKey | RRJLJKRFFRZRAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB 228357 (CHEBI:8979) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonym | Source |
|---|---|
| SB 228357 | KEGG COMPOUND |