EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14F3N3OS |
| Net Charge | 0 |
| Average Mass | 353.369 |
| Monoisotopic Mass | 353.08097 |
| SMILES | CSc1cc2c(cc1C(F)(F)F)N(C(=O)Nc1cccnc1)CC2 |
| InChI | InChI=1S/C16H14F3N3OS/c1-24-14-7-10-4-6-22(13(10)8-12(14)16(17,18)19)15(23)21-11-3-2-5-20-9-11/h2-3,5,7-9H,4,6H2,1H3,(H,21,23) |
| InChIKey | OQZOXHCRSXYSPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB 221284 (CHEBI:8978) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonym | Source |
|---|---|
| SB 221284 | KEGG COMPOUND |