EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | COC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C9H8O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-5H,1H3,(H,10,11) |
| InChIKey | FNJSWIPFHMKRAT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (15995852) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Monomethyl phthalate (CHEBI:89749) is a methyl ester (CHEBI:25248) |
| Monomethyl phthalate (CHEBI:89749) is a phthalic acid monoester (CHEBI:132610) |
| Synonyms | Source |
|---|---|
| Methyl hydrogen phthalate | HMDB |
| Monomethyl 1,2-benzenedicarboxylate | HMDB |
| Methyl phthalate | HMDB |
| O-(Methoxycarbonyl)benzoate | HMDB |
| 2-(Methoxycarbonyl)benzoate | HMDB |
| 2-(methoxycarbonyl)benzoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| D3 | Wikipedia |
| HMDB0002130 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:4376-18-5 | KEGG COMPOUND |
| Citations |
|---|