EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H39NO5 |
| Net Charge | 0 |
| Average Mass | 385.545 |
| Monoisotopic Mass | 385.28282 |
| SMILES | CCCCCCCC/C=C\CC(O)CC(=O)O[C@@H](CCC(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C21H39NO5/c1-5-6-7-8-9-10-11-12-13-14-18(23)17-21(26)27-19(22(2,3)4)15-16-20(24)25/h12-13,18-19,23H,5-11,14-17H2,1-4H3/b13-12-/t18?,19-/m0/s1 |
| InChIKey | BCZXLGKYFZTAJX-JDWANTKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (24023812) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxy-cis-5-tetradecenoylcarnitine (CHEBI:89748) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| 3-Hydroxy-5-tetradecenoylcarnitine | HMDB |
| 3-Hydroxy-5(Z)-tetradecenoylcarnitine | HMDB |
| 3-Hydroxy-5Z-tetradecenoylcarnitine | HMDB |
| 3-Hydroxytetradecenoylcarnitine | HMDB |
| (4S)-4-{[(5Z)-3-hydroxytetradec-5-enoyl]oxy}-4-(trimethylazaniumyl)butanoate | HMDB |
| Hydroxytetradecenoyl-L-carnitine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013330 | HMDB |
| Citations |
|---|