EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41NO4 |
| Net Charge | 0 |
| Average Mass | 395.584 |
| Monoisotopic Mass | 395.30356 |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)O[C@@H](CCC(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C23H41NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(27)28-21(24(2,3)4)19-20-22(25)26/h7-8,10-11,21H,5-6,9,12-20H2,1-4H3/b8-7-,11-10-/t21-/m0/s1 |
| InChIKey | AHZCIODFJPNPKS-XBDLETADSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood (UBERON:0000178) | PubMed (21359215) | ||
| saliva (UBERON:0001836) | Article (Dame, ZT. et al. (2014) The Human Saliva Metabolome (manuscript in preparation)) | ||
| urine (BTO:0001419) | PubMed (24023812) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,12-Hexadecadienoylcarnitine (CHEBI:89745) is a polyunsaturated fatty ester (CHEBI:145039) |
| Synonyms | Source |
|---|---|
| (4S)-4-[(9Z,12Z)-hexadeca-9,12-dienoyloxy]-4-(trimethylazaniumyl)butanoate | HMDB |
| 9,12-Hexadecadienylcarnitine | HMDB |
| 9(Z),12(Z)-Hexadecadienoylcarnitine | HMDB |
| 9Z,12Z-Hexadecadienoylcarnitine | HMDB |
| Acyl carnitine C16:2 | HMDB |
| Hexadecadienyl-L-carnitine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013334 | HMDB |
| Citations |
|---|