EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O4 |
| Net Charge | 0 |
| Average Mass | 200.234 |
| Monoisotopic Mass | 200.10486 |
| SMILES | O=C(O)CC/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C10H16O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1,3H,2,4-8H2,(H,11,12)(H,13,14)/b3-1- |
| InChIKey | CXGDCGIPEJKSCK-IWQZZHSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | Article (MetaGene: http://www.metagene.de/program/d.prg?mp=MEDIUM%20CHAIN%20ACYL-COA%20DEHYDROGENASE%20DEFICIENCY%20(MCAD)) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-4-Decenedioic acid (CHEBI:89730) is a dicarboxylic fatty acid (CHEBI:189840) |
| cis-4-Decenedioic acid (CHEBI:89730) is a monounsaturated fatty acid (CHEBI:25413) |
| Synonyms | Source |
|---|---|
| Decenedioate | HMDB |
| Decenedioic acid | HMDB |
| (4Z)-dec-4-enedioic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000603 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:72879-22-2 | KEGG COMPOUND |