EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14INO2 |
| Net Charge | 0 |
| Average Mass | 355.175 |
| Monoisotopic Mass | 355.00693 |
| SMILES | NCCc1ccc(Oc2ccc(O)cc2)c(I)c1 |
| InChI | InChI=1S/C14H14INO2/c15-13-9-10(7-8-16)1-6-14(13)18-12-4-2-11(17)3-5-12/h1-6,9,17H,7-8,16H2 |
| InChIKey | XIINYOJWNGOUPF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133blood serum) | PubMed (21490071) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | trace amine-associated receptor 1 agonist An agonist that selectively binds to and activates trace amine-associated receptor 1. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. anti-obesity agent Any substance which is used to reduce or control weight. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-iodothyronamine (CHEBI:89700) has role anti-inflammatory agent (CHEBI:67079) |
| 3-iodothyronamine (CHEBI:89700) has role anti-obesity agent (CHEBI:74518) |
| 3-iodothyronamine (CHEBI:89700) has role apoptosis inhibitor (CHEBI:68494) |
| 3-iodothyronamine (CHEBI:89700) has role cardioprotective agent (CHEBI:77307) |
| 3-iodothyronamine (CHEBI:89700) has role human blood serum metabolite (CHEBI:85234) |
| 3-iodothyronamine (CHEBI:89700) has role neuroprotective agent (CHEBI:63726) |
| 3-iodothyronamine (CHEBI:89700) has role trace amine-associated receptor 1 agonist (CHEBI:228347) |
| 3-iodothyronamine (CHEBI:89700) is a aromatic ether (CHEBI:35618) |
| 3-iodothyronamine (CHEBI:89700) is a organoiodine compound (CHEBI:37142) |
| 3-iodothyronamine (CHEBI:89700) is a phenols (CHEBI:33853) |
| 3-iodothyronamine (CHEBI:89700) is a primary amino compound (CHEBI:50994) |
| 3-iodothyronamine (CHEBI:89700) is conjugate base of 3-iodothyronamine(1+) (CHEBI:231647) |
| Incoming Relation(s) |
| 3-iodothyronamine(1+) (CHEBI:231647) is conjugate acid of 3-iodothyronamine (CHEBI:89700) |
| IUPAC Name |
|---|
| 4-[4-(2-aminoethyl)-2-iodophenoxy]phenol |
| Synonyms | Source |
|---|---|
| 3-T1AM | ChEBI |
| 3-T1AM | ChEBI |
| 4-[4-(2-azanylethyl)-2-iodanyl-phenoxy]phenol | PDBeChem |
| T1AM | ChEBI |
| T1AM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3-Iodothyronamine | Wikipedia |
| FDB111734 | FooDB |
| HMDB0060524 | HMDB |
| UJF | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:712349-95-6 | ChEBI |
| Citations |
|---|