EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14INO2 |
| Net Charge | 0 |
| Average Mass | 355.175 |
| Monoisotopic Mass | 355.00693 |
| SMILES | NCCc1ccc(Oc2ccc(O)cc2)c(I)c1 |
| InChI | InChI=1S/C14H14INO2/c15-13-9-10(7-8-16)1-6-14(13)18-12-4-2-11(17)3-5-12/h1-6,9,17H,7-8,16H2 |
| InChIKey | XIINYOJWNGOUPF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133blood serum) | PubMed (21490071) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-obesity agent Any substance which is used to reduce or control weight. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. trace amine-associated receptor 1 agonist An agonist that selectively binds to and activates trace amine-associated receptor 1. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. cardioprotective agent Any protective agent that is able to prevent damage to the heart. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-iodothyronamine (CHEBI:89700) has role anti-inflammatory agent (CHEBI:67079) |
| 3-iodothyronamine (CHEBI:89700) has role anti-obesity agent (CHEBI:74518) |
| 3-iodothyronamine (CHEBI:89700) has role apoptosis inhibitor (CHEBI:68494) |
| 3-iodothyronamine (CHEBI:89700) has role cardioprotective agent (CHEBI:77307) |
| 3-iodothyronamine (CHEBI:89700) has role human blood serum metabolite (CHEBI:85234) |
| 3-iodothyronamine (CHEBI:89700) has role neuroprotective agent (CHEBI:63726) |
| 3-iodothyronamine (CHEBI:89700) has role trace amine-associated receptor 1 agonist (CHEBI:228347) |
| 3-iodothyronamine (CHEBI:89700) is a aromatic ether (CHEBI:35618) |
| 3-iodothyronamine (CHEBI:89700) is a organoiodine compound (CHEBI:37142) |
| 3-iodothyronamine (CHEBI:89700) is a phenols (CHEBI:33853) |
| 3-iodothyronamine (CHEBI:89700) is a primary amino compound (CHEBI:50994) |
| 3-iodothyronamine (CHEBI:89700) is conjugate base of 3-iodothyronamine(1+) (CHEBI:231647) |
| Incoming Relation(s) |
| 3-iodothyronamine(1+) (CHEBI:231647) is conjugate acid of 3-iodothyronamine (CHEBI:89700) |
| IUPAC Name |
|---|
| 4-[4-(2-aminoethyl)-2-iodophenoxy]phenol |
| Synonyms | Source |
|---|---|
| 3-T1AM | ChEBI |
| 3-T1AM | ChEBI |
| 4-[4-(2-azanylethyl)-2-iodanyl-phenoxy]phenol | PDBeChem |
| T1AM | ChEBI |
| T1AM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3-Iodothyronamine | Wikipedia |
| FDB111734 | FooDB |
| HMDB0060524 | HMDB |
| UJF | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:712349-95-6 | ChEBI |
| Citations |
|---|