EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20 |
| Net Charge | 0 |
| Average Mass | 200.325 |
| Monoisotopic Mass | 200.15650 |
| SMILES | CC1(C)C2=CC=CC(C)(C)C23C=CC1C3 |
| InChI | InChI=1S/C15H20/c1-13(2)8-5-6-12-14(3,4)11-7-9-15(12,13)10-11/h5-9,11H,10H2,1-4H3 |
| InChIKey | MOLSSUUBCUMURN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fumigatus (ncbitaxon:746128) | - | PubMed (24906414) | |
| Helianthus annuus (ncbitaxon:4232) | - | PubMed (33187052) | |
| Helichrysum microphyllum (ncbitaxon:261789) | - | PubMed (31303817) | |
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (25805727) | Present in the headspace gas of Plasmodium-infected red blood cells. |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. insect attractant A chemical that attracts insects. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) has role Aspergillus metabolite (CHEBI:76956) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) has role human metabolite (CHEBI:77746) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) has role insect attractant (CHEBI:24850) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) has role plant metabolite (CHEBI:76924) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) has role volatile oil component (CHEBI:27311) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) is a carbotricyclic compound (CHEBI:38032) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) is a polycyclic olefin (CHEBI:35714) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) is a sesquiterpene (CHEBI:35189) |
| 4,5,9,10-dehydroisolongifolene (CHEBI:89675) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 1,1,5,5-tetramethyl-1,5-dihydro-2H-2,4a-methanonaphthalene |
| Synonyms | Source |
|---|---|
| 2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undeca-3,5,9-triene | IUPAC |
| 4,5,9,10-dehydro-isolongifolene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 511806 | ChemSpider |
| HMDB0059829 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:156747-45-4 | NIST Chemistry WebBook |
| Citations |
|---|