EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H10N2O4 |
| Net Charge | 0 |
| Average Mass | 318.288 |
| Monoisotopic Mass | 318.06406 |
| SMILES | Cc1c(=O)c(=O)c2c3cnc4c(C)c(=O)c(=O)c(c5cnc1c52)c43 |
| InChI | InChI=1S/C18H10N2O4/c1-5-13-9-7(3-19-13)12-10-8(11(9)17(23)15(5)21)4-20-14(10)6(2)16(22)18(12)24/h3-4,19-20H,1-2H3 |
| InChIKey | XUMBMVFBXHLACL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Melanin (CHEBI:89634) is a melanins (CHEBI:25179) |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004068 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:8049-97-6 | KEGG COMPOUND |