EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO |
| Net Charge | 0 |
| Average Mass | 137.182 |
| Monoisotopic Mass | 137.08406 |
| SMILES | NCCc1cccc(O)c1 |
| InChI | InChI=1S/C8H11NO/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,10H,4-5,9H2 |
| InChIKey | GHFGJTVYMNRGBY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO_0000131) | PubMed (8232728) | ||
| urine (BTO:0001419) | PubMed (8255370) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| m-tyramine (CHEBI:89626) has role human urinary metabolite (CHEBI:84087) |
| m-tyramine (CHEBI:89626) has role neurotransmitter (CHEBI:25512) |
| m-tyramine (CHEBI:89626) is a primary amino compound (CHEBI:50994) |
| m-tyramine (CHEBI:89626) is a tyramines (CHEBI:27175) |
| m-tyramine (CHEBI:89626) is conjugate base of m-tyraminium (CHEBI:144800) |
| Incoming Relation(s) |
| m-tyraminium (CHEBI:144800) is conjugate acid of m-tyramine (CHEBI:89626) |
| IUPAC Name |
|---|
| 3-(2-aminoethyl)phenol |
| Synonyms | Source |
|---|---|
| 2-(3-hydroxyphenyl)ethylamine | HMDB |
| 3-(2-aminoethyl)phenol | ChemIDplus |
| 3-hydroxyphenethylamine | HMDB |
| 3-hydroxyphenylethylamine | ChemIDplus |
| 3-tyramine | ChemIDplus |
| m-hydroxyphenethylamine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| FDB023573 | FooDB |
| HMDB0004989 | HMDB |
| Meta-Tyramine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:588-05-6 | ChemIDplus |
| Citations |
|---|