EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O3S2 |
| Net Charge | 0 |
| Average Mass | 262.356 |
| Monoisotopic Mass | 262.04458 |
| SMILES | C=CCNC(=S)SCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C9H14N2O3S2/c1-3-4-10-9(15)16-5-7(8(13)14)11-6(2)12/h3,7H,1,4-5H2,2H3,(H,10,15)(H,11,12)(H,13,14) |
| InChIKey | DJFUZUUKZXAXBZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (8000299) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-S-(N-allylthiocarbamoyl)-L-cysteine (CHEBI:89611) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| N-Acetyl-S-(allylcarbamothioyl)cysteine | HMDB |
| 2-acetamido-3-{[(prop-2-en-1-yl)carbamothioyl]sulfanyl}propanoic acid | HMDB |
| 2-acetamido-3-(prop-2-enylcarbamothioylsulfanyl)propanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060011 | HMDB |
| Citations |
|---|