EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O |
| Net Charge | 0 |
| Average Mass | 194.318 |
| Monoisotopic Mass | 194.16707 |
| SMILES | CC1=CCCC(C)(C)C12CCC(C)O2 |
| InChI | InChI=1S/C13H22O/c1-10-6-5-8-12(3,4)13(10)9-7-11(2)14-13/h6,11H,5,7-9H2,1-4H3 |
| InChIKey | GYUZHTWCNKINPY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rydingia integrifolia (ncbitaxon:483857) | leaf (BTO:0000713) | DOI (10.1016/j.phytochem.2004.03.012) | Species also known as Otostegia integrifolia. |
| Ulex europaeus (ncbitaxon:3902) | - | PubMed (30372468) | |
| Vitex doniana (ncbitaxon:479623) | - | PubMed (28286547) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theaspirane (CHEBI:89598) has role flavouring agent (CHEBI:35617) |
| theaspirane (CHEBI:89598) has role fragrance (CHEBI:48318) |
| theaspirane (CHEBI:89598) has role volatile oil component (CHEBI:27311) |
| theaspirane (CHEBI:89598) is a norisoprenoid (CHEBI:172402) |
| theaspirane (CHEBI:89598) is a olefinic compound (CHEBI:78840) |
| theaspirane (CHEBI:89598) is a oxaspiro compound (CHEBI:37948) |
| theaspirane (CHEBI:89598) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 2,6,10,10-tetramethyl-1-oxaspiro[4.5]dec-6-ene |
| Synonyms | Source |
|---|---|
| 1-oxaspiro-2,6,10,10-tetramethyl[4.5]dec-6-ene | HMDB |
| 1-Oxaspiro-[4,5]-2,6,10,10-tetramethyl-6-decene | ChEBI |
| FEMA 3774 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 55810 | ChemSpider |
| FDB015771 | FooDB |
| HMDB0036823 | HMDB |
| US2009270516 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1424383 | Reaxys |
| CAS:36431-72-8 | NIST Chemistry WebBook |
| CAS:36431-72-8 | ChemIDplus |
| Citations |
|---|