EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O3 |
| Net Charge | 0 |
| Average Mass | 266.381 |
| Monoisotopic Mass | 266.18819 |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C\CCC(=O)O |
| InChI | InChI=1S/C16H26O3/c1-2-3-4-5-6-9-12-15(17)13-10-7-8-11-14-16(18)19/h6-10,13,15,17H,2-5,11-12,14H2,1H3,(H,18,19)/b8-7-,9-6-,13-10+/t15-/m0/s1 |
| InChIKey | KBOVKDIBOBQLRS-ONCCEEIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (20671299) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tetranor 12-HETE (CHEBI:89569) is a hydroxy fatty acid (CHEBI:24654) |
| Synonyms | Source |
|---|---|
| (4Z,6E,8S,10Z)-8-hydroxyhexadeca-4,6,10-trienoic acid | HMDB |
| (4Z,6E,8S,10Z)-8-hydroxyhexadeca-4,6,10-trienoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060055 | HMDB |
| Citations |
|---|