EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O8S |
| Net Charge | 0 |
| Average Mass | 304.276 |
| Monoisotopic Mass | 304.02529 |
| SMILES | COc1cc(/C=C/C(=O)OS(=O)(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C11H12O8S/c1-17-8-5-7(6-9(18-2)11(8)13)3-4-10(12)19-20(14,15)16/h3-6,13H,1-2H3,(H,14,15,16)/b4-3+ |
| InChIKey | LAHUBJBDDCZJTK-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (22827565) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sinapinic acid-O-sulphate (CHEBI:89552) is a hydroxycinnamic acid (CHEBI:24689) |
| Synonym | Source |
|---|---|
| sulfo (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060020 | HMDB |
| Citations |
|---|