EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | CN1CCc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C10H13NO2/c1-11-3-2-7-4-9(12)10(13)5-8(7)6-11/h4-5,12-13H,2-3,6H2,1H3 |
| InChIKey | WETXYFNVBDLWIW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| cerebrospinal fluid (UBERON:0001359) | PubMed (7595645) | ||
| brain (BTO:0000142) | PubMed (2049084) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methylnorsalsolinol (CHEBI:89546) has functional parent norsalsolinol (CHEBI:173739) |
| N-methylnorsalsolinol (CHEBI:89546) has role human metabolite (CHEBI:77746) |
| N-methylnorsalsolinol (CHEBI:89546) has role neurotoxin (CHEBI:50910) |
| N-methylnorsalsolinol (CHEBI:89546) has role rat metabolite (CHEBI:86264) |
| N-methylnorsalsolinol (CHEBI:89546) is a isoquinolinol (CHEBI:24923) |
| N-methylnorsalsolinol (CHEBI:89546) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| Synonyms | Source |
|---|---|
| 1,2,3,4-tetrahydro-2-methyl-6,7-isoquinolinediol | HMDB |
| 2-methyl-6,7-dihydroxy-1,2,3,4-tetrahydroisoquinoline | HMDB |
| 2-methyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol | ChEBI |
| N-methyl-norsalsolinol | ChEBI |
| 2-MDTIQ | ChEBI |
| 2(N)-methyl-norsalsolinol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001189 | HMDB |
| FDB022477 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:37491-98-8 | ChemIDplus |
| Citations |
|---|