EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O3 |
| Net Charge | 0 |
| Average Mass | 306.446 |
| Monoisotopic Mass | 306.21949 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)[C@H](O)C[C@@]21[H] |
| InChI | InChI=1S/C19H30O3/c1-18-7-5-12(20)9-11(18)3-4-13-14(18)6-8-19(2)15(13)10-16(21)17(19)22/h3,12-17,20-22H,4-10H2,1-2H3/t12-,13+,14-,15-,16+,17-,18-,19-/m0/s1 |
| InChIKey | GUGSXATYPSGVAY-DHKQUUGRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (11085621) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Androstenetriol (CHEBI:89531) has role androgen (CHEBI:50113) |
| 5-Androstenetriol (CHEBI:89531) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonym | Source |
|---|---|
| (1S,2R,5S,10R,11S,13R,14R,15S)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-ene-5,13,14-triol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000550 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:4150-30-5 | KEGG COMPOUND |
| Citations |
|---|