EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O |
| Net Charge | 0 |
| Average Mass | 96.129 |
| Monoisotopic Mass | 96.05751 |
| SMILES | Cc1coc(C)c1 |
| InChI | InChI=1S/C6H8O/c1-5-3-6(2)7-4-5/h3-4H,1-2H3 |
| InChIKey | AABTWRKUKUPMJG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | saliva (UBERON:0001836) | PubMed (24421258) | |
| Olea europaea (ncbitaxon:4146) | - | DOI (10.1007/s11746-998-0205-6) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dimethylfuran (CHEBI:89526) has role flavouring agent (CHEBI:35617) |
| 2,4-dimethylfuran (CHEBI:89526) has role human metabolite (CHEBI:77746) |
| 2,4-dimethylfuran (CHEBI:89526) has role plant metabolite (CHEBI:76924) |
| 2,4-dimethylfuran (CHEBI:89526) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 2,4-dimethylfuran |
| Synonym | Source |
|---|---|
| 2,4-dimethyl-furan | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 18339 | ChemSpider |
| FDB010951 | FooDB |
| HMDB0032965 | HMDB |
| Citations |
|---|