EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:89524 - epietiocholanolone
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16,20H,3-11H2,1-2H3/t12-,13+,14+,15+,16+,18+,19+/m1/s1 |
| InChIKey | QGXBDMJGAMFCBF-XRJZGPCZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epinephelus fuscoguttatus (ncbitaxon:293821) | - | DOI (10.1088/1757-899X/515/1/012044) | |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (17716701) | |
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | PubMed (1248804) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epietiocholanolone (CHEBI:89524) has parent hydride 5β-androstane (CHEBI:20659) |
| epietiocholanolone (CHEBI:89524) has role androgen (CHEBI:50113) |
| epietiocholanolone (CHEBI:89524) has role animal metabolite (CHEBI:75767) |
| epietiocholanolone (CHEBI:89524) has role human blood serum metabolite (CHEBI:85234) |
| epietiocholanolone (CHEBI:89524) has role mouse metabolite (CHEBI:75771) |
| epietiocholanolone (CHEBI:89524) has role rat metabolite (CHEBI:86264) |
| epietiocholanolone (CHEBI:89524) is a 17-oxo steroid (CHEBI:19168) |
| epietiocholanolone (CHEBI:89524) is a 3β-hydroxy steroid (CHEBI:36836) |
| epietiocholanolone (CHEBI:89524) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β-hydroxy-5β-androstan-17-one |
| Synonyms | Source |
|---|---|
| (3β,5β)-3-hydroxyandrostan-17-one | ChemIDplus |
| 3β-etiocholanolone | ChemIDplus |
| 3β-hydroxy-17-oxo-5β-androstane | HMDB |
| 3β-hydroxy-5β-androstane-17-one | HMDB |
| 3β-hydroxyetiocholan-17-one | HMDB |
| 5β-androstan-3β-ol-17-one | HMDB |
| UniProt Name | Source |
|---|---|
| 3β-hydroxy-5β-androstane-17-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 216866 | ChemSpider |
| Epietiocholanolone | Wikipedia |
| FDB022109 | FooDB |
| HMDB0000546 | HMDB |
| LMST02020104 | LIPID MAPS |
| Citations |
|---|