EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:89524 - epietiocholanolone
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16,20H,3-11H2,1-2H3/t12-,13+,14+,15+,16+,18+,19+/m1/s1 |
| InChIKey | QGXBDMJGAMFCBF-XRJZGPCZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epinephelus fuscoguttatus (ncbitaxon:293821) | - | DOI (10.1088/1757-899X/515/1/012044) | |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (17716701) | |
| Mus musculus (ncbitaxon:10090) | liver (BTO:0000759) | PubMed (1248804) |
| Roles Classification |
|---|
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epietiocholanolone (CHEBI:89524) has parent hydride 5β-androstane (CHEBI:20659) |
| epietiocholanolone (CHEBI:89524) has role androgen (CHEBI:50113) |
| epietiocholanolone (CHEBI:89524) has role animal metabolite (CHEBI:75767) |
| epietiocholanolone (CHEBI:89524) has role human blood serum metabolite (CHEBI:85234) |
| epietiocholanolone (CHEBI:89524) has role mouse metabolite (CHEBI:75771) |
| epietiocholanolone (CHEBI:89524) has role rat metabolite (CHEBI:86264) |
| epietiocholanolone (CHEBI:89524) is a 17-oxo steroid (CHEBI:19168) |
| epietiocholanolone (CHEBI:89524) is a 3β-hydroxy steroid (CHEBI:36836) |
| epietiocholanolone (CHEBI:89524) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β-hydroxy-5β-androstan-17-one |
| Synonyms | Source |
|---|---|
| (3β,5β)-3-hydroxyandrostan-17-one | ChemIDplus |
| 3β-etiocholanolone | ChemIDplus |
| 3β-hydroxy-17-oxo-5β-androstane | HMDB |
| 3β-hydroxy-5β-androstane-17-one | HMDB |
| 3β-hydroxyetiocholan-17-one | HMDB |
| 5β-androstan-3β-ol-17-one | HMDB |
| UniProt Name | Source |
|---|---|
| 3β-hydroxy-5β-androstane-17-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 216866 | ChemSpider |
| Epietiocholanolone | Wikipedia |
| FDB022109 | FooDB |
| HMDB0000546 | HMDB |
| LMST02020104 | LIPID MAPS |
| Citations |
|---|