EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NOS2 |
| Net Charge | 0 |
| Average Mass | 163.267 |
| Monoisotopic Mass | 163.01256 |
| SMILES | CS(=O)CCCN=C=S |
| InChI | InChI=1S/C5H9NOS2/c1-9(7)4-2-3-6-5-8/h2-4H2,1H3 |
| InChIKey | LELAOEBVZLPXAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | quorum sensing inhibitor Any compound that interferes with bacterial communication (quorum sensing, QS). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iberin (CHEBI:89494) has role apoptosis inducer (CHEBI:68495) |
| iberin (CHEBI:89494) has role plant metabolite (CHEBI:76924) |
| iberin (CHEBI:89494) has role quorum sensing inhibitor (CHEBI:138977) |
| iberin (CHEBI:89494) is a isothiocyanate (CHEBI:52221) |
| iberin (CHEBI:89494) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 1-isothiocyanato-3-(methylsulfinyl)propane |
| Synonyms | Source |
|---|---|
| 3-isothiocyanatopropyl methyl sulfoxide | IUPAC |
| IMSP | ChEBI |
| methylsulfinylpropylisothiocyanate | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| FDB023829 | FooDB |
| HMDB0006095 | HMDB |
| Citations |
|---|