EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NOS2 |
| Net Charge | 0 |
| Average Mass | 163.267 |
| Monoisotopic Mass | 163.01256 |
| SMILES | CS(=O)CCCN=C=S |
| InChI | InChI=1S/C5H9NOS2/c1-9(7)4-2-3-6-5-8/h2-4H2,1H3 |
| InChIKey | LELAOEBVZLPXAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. quorum sensing inhibitor Any compound that interferes with bacterial communication (quorum sensing, QS). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iberin (CHEBI:89494) has role apoptosis inducer (CHEBI:68495) |
| iberin (CHEBI:89494) has role plant metabolite (CHEBI:76924) |
| iberin (CHEBI:89494) has role quorum sensing inhibitor (CHEBI:138977) |
| iberin (CHEBI:89494) is a isothiocyanate (CHEBI:52221) |
| iberin (CHEBI:89494) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 1-isothiocyanato-3-(methylsulfinyl)propane |
| Synonyms | Source |
|---|---|
| 3-isothiocyanatopropyl methyl sulfoxide | IUPAC |
| IMSP | ChEBI |
| methylsulfinylpropylisothiocyanate | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| FDB023829 | FooDB |
| HMDB0006095 | HMDB |
| Citations |
|---|