EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O4 |
| Net Charge | 0 |
| Average Mass | 298.338 |
| Monoisotopic Mass | 298.12051 |
| SMILES | CC1=C(C/C=C(\C)CCC(=O)O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18O4/c1-11(8-10-16(19)20)7-9-13-12(2)17(21)14-5-3-4-6-15(14)18(13)22/h3-7H,8-10H2,1-2H3,(H,19,20)/b11-7+ |
| InChIKey | BCNIZSHMXASUGF-YRNVUSSQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (17585028) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-3-[(2E)-5-carboxy-3-methylpent-2-enyl]-1,4-naphthoquinone (CHEBI:89489) has role human urinary metabolite (CHEBI:84087) |
| 2-methyl-3-[(2E)-5-carboxy-3-methylpent-2-enyl]-1,4-naphthoquinone (CHEBI:89489) is a 1,4-naphthoquinones (CHEBI:132142) |
| 2-methyl-3-[(2E)-5-carboxy-3-methylpent-2-enyl]-1,4-naphthoquinone (CHEBI:89489) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (4E)-4-methyl-6-(3-methyl-1,4-dioxo-1,4-dihydronaphthalen-2-yl)hex-4-enoic acid |
| Synonyms | Source |
|---|---|
| (4E)-4-methyl-6-(3-methyl-1,4-naphthoquinon-2-yl)hex-4-enoic acid | ChEBI |
| trans-2-methyl-3-(5'-carboxy-3'-methylpent-2'-enyl)-1,4-naphthoquinone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004808 | HMDB |
| Citations |
|---|