EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO3 |
| Net Charge | 0 |
| Average Mass | 169.180 |
| Monoisotopic Mass | 169.07389 |
| SMILES | NCCc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO3/c9-2-1-5-3-6(10)8(12)7(11)4-5/h3-4,10-12H,1-2,9H2 |
| InChIKey | LCAINUZZHIZKKS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (8255370) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxydopamine (CHEBI:89485) is a catecholamine (CHEBI:33567) |
| 5-Hydroxydopamine (CHEBI:89485) is conjugate base of 5-hydroxydopaminium (CHEBI:231767) |
| Incoming Relation(s) |
| 5-hydroxydopaminium (CHEBI:231767) is conjugate acid of 5-Hydroxydopamine (CHEBI:89485) |
| Synonyms | Source |
|---|---|
| 3,4,5-Trihydroxyphenethylamine | HMDB |
| 3,4,5-Trihydroxyphenylethylamine | HMDB |
| 5-(2-Aminoethyl)1,2,3-Benzenetriol | HMDB |
| 5-(2-aminoethyl)benzene-1,2,3-triol | HMDB |
| 5-(2-Aminoethyl)benzene-1,2,3-triol | HMDB |
| 5-(2-Aminoethyl)-Pyrogallol | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004817 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1927-04-4 | KEGG COMPOUND |
| Citations |
|---|