EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7NO4S |
| Net Charge | 0 |
| Average Mass | 189.192 |
| Monoisotopic Mass | 189.00958 |
| SMILES | O=C(O)C1=NC(C(=O)O)CSC1 |
| InChI | InChI=1S/C6H7NO4S/c8-5(9)3-1-12-2-4(7-3)6(10)11/h3H,1-2H2,(H,8,9)(H,10,11) |
| InChIKey | XIVVIYYWXOMYOD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (3254164) | ||
| brain (BTO:0000142) | PubMed (9232634) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lanthionine ketimine (CHEBI:89479) has role anti-inflammatory agent (CHEBI:67079) |
| lanthionine ketimine (CHEBI:89479) has role human urinary metabolite (CHEBI:84087) |
| lanthionine ketimine (CHEBI:89479) has role neuroprotective agent (CHEBI:63726) |
| lanthionine ketimine (CHEBI:89479) is a 1,4-thiazine (CHEBI:46976) |
| lanthionine ketimine (CHEBI:89479) is a dicarboxylic acid (CHEBI:35692) |
| lanthionine ketimine (CHEBI:89479) is a sulfur-containing amino acid (CHEBI:26834) |
| IUPAC Name |
|---|
| 3,6-dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 118424 | ChemSpider |
| CPD-16728 | MetaCyc |
| FDB023431 | FooDB |
| HMDB0004823 | HMDB |
| Lanthionine_ketimine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:83711-67-5 | ChemIDplus |
| Citations |
|---|